Molecular Definition

Canonical SMILES COc1ccc(Nc2ccc3nnn4c5ccccc5C(=O)c2c34)cc1
Formula C20H14N4O2
Molecular Weight 342.35 da
Stereocenters 0/0