Molecular Definition

Canonical SMILES Oc1ccc(cc1O)C(=O)Cn2cnc3ccccc23
Formula C15H12N2O3
Molecular Weight 268.27 da
Stereocenters 0/0