Molecular Definition

Canonical SMILES [H][C@]12C[C@]([H])([C@@H](OC)[C@](C)(O1)N1C3=CC=CC=C3C3=C4CNC(=O)C4=C4C5=CC=CC=C5N2C4=C13)N(C)C(=O)C1=CC=CC=C1
Formula C35H30N4O4
Molecular Weight 570.64 da
Stereocenters 4/4