Molecular Definition

Canonical SMILES CC(C)COc1cccc(c1O)c2cc3cc(ccc3[nH]2)C(=N)N
Formula C19H21N3O2
Molecular Weight 323.39 da
Stereocenters 0/0