Molecular Definition

Canonical SMILES CN([C@@H]1CCCC[C@@H]1N2CCCC2)C(=O)OCc3ccccc3
Formula C19H28N2O2
Molecular Weight 316.44 da
Stereocenters 2/2