Molecular Definition

Canonical SMILES OCCCNc1ccc2nnn3c4ccc(Br)cc4C(=O)c1c23
Formula C16H13BrN4O2
Molecular Weight 373.20 da
Stereocenters 0/0