Molecular Definition

Canonical SMILES CC(C)CCNc1ccc2nnn3c4ccc(Br)cc4C(=O)c1c23
Formula C18H17BrN4O
Molecular Weight 385.26 da
Stereocenters 0/0