Molecular Definition

Canonical SMILES Cc1ccc(Cl)c(c1)N2CCN(CCN3C(=O)CC4(CCCC4)CC3=O)CC2
Formula C22H30ClN3O2
Molecular Weight 403.95 da
Stereocenters 0/0