Target Relevance

Molecular Definition

Canonical SMILES COC(=O)[C@]1(COC(=O)\C=C\c2ccccc2)[C@H]3C[C@@H]4N(C/C/3=C/C)[C@@H]5C[C@]16c7cc(OC)ccc7N(C)[C@]46O5
Formula C32H34N2O6
Molecular Weight 542.62 da
Stereocenters 6/6