Molecular Definition

Canonical SMILES CCCOCCN1C(=O)C(=Nc2ncc(cc12)c3ccc(OC)nc3)N[C@H](C)CO
Formula C21H27N5O4
Molecular Weight 413.47 da
Stereocenters 1/1