Molecular Definition

Canonical SMILES CCN(CC)c1nc(NC2CCN(C)CC2)c3cc(OC)c(OC)cc3n1
Formula C20H31N5O2
Molecular Weight 373.49 da
Stereocenters 0/0