Target Relevance

Molecular Definition

Canonical SMILES OCCCn1cnc2c(NCc3cccc(c3)c4cn(c5ccccc45)S(=O)(=O)c6ccccc6)nc(nc12)C#N
Formula C30H25N7O3S
Molecular Weight 563.63 da
Stereocenters 0/0