Target Relevance

Molecular Definition

Canonical SMILES CCCCCCSCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O
Formula C16H29N3O6S
Molecular Weight 391.48 da
Stereocenters 0/2