Target Relevance

Molecular Definition

Canonical SMILES [3H]c1ccccc1N2[C@@H]([C@@H](CC[C@H](O)c3ccc(F)cc3)C2=O)c4ccc(O[C@@H]5O[C@@H]([C@@H](O)[C@H](O)[C@H]5O)C(=O)O)c([3H])c4
Formula C30H30FNO9
Molecular Weight 571.58 da
Stereocenters 8/8