Target Relevance

Molecular Definition

Canonical SMILES C[35S](=O)(=O)NCC#Cc1ccc(cc1)N2[C@@H]([C@@H](CC[C@H](O)c3ccc(F)cc3)C2=O)c4ccc(O[C@@H]5O[C@@H]([C@@H](O)[C@H](O)[C@H]5O)C(=O)O)cc4
Formula C34H35FN2O11S
Molecular Weight 701.62 da
Stereocenters 8/8