Molecular Definition

Canonical SMILES COc1cc2nc(nc(NC3CCN(C)CC3)c2cc1OC)N4CCCN(C)CC4
Formula C22H34N6O2
Molecular Weight 414.54 da
Stereocenters 0/0