Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(CCNC(=O)c2nn(c3ccc(F)cc3F)c(c2C)n4c(C)ccc4C)cc1Cl
Formula C26H25ClF2N4O2
Molecular Weight 498.95 da
Stereocenters 0/0