Molecular Definition

Canonical SMILES COc1cc2nc(nc(NC3CCN(C)CC3)c2cc1OC)N(C)C
Formula C18H27N5O2
Molecular Weight 345.44 da
Stereocenters 0/0