Molecular Definition

Canonical SMILES CCCOCCN1C(=O)C(=Nc2cnc(cc12)c3ccc(OC)nc3)NCC(=O)N4CCNCC4
Formula C24H31N7O4
Molecular Weight 481.55 da
Stereocenters 0/0