Molecular Definition

Canonical SMILES COc1cc2nc(nc(NC3CCN(C)CC3)c2cc1OC)N4CCOCC4
Formula C20H29N5O3
Molecular Weight 387.48 da
Stereocenters 0/0