Molecular Definition

Canonical SMILES OC(=O)[C@@H]1Cc2cc(NC(=O)CCCc3cccs3)ccc2CO1
Formula C18H19NO4S
Molecular Weight 345.41 da
Stereocenters 1/1