Molecular Definition

Canonical SMILES OC1=C(CC2=C(O)c3ccc4CCCCc4c3OC2=O)C(=O)Oc5c6CCCCc6ccc15
Formula C27H24O6
Molecular Weight 444.48 da
Stereocenters 0/0