Molecular Definition

Canonical SMILES COc1ccc2C(=C(CC3=C(O)c4ccc(OC)cc4OC3=O)C(=O)Oc2c1)O
Formula C21H16O8
Molecular Weight 396.35 da
Stereocenters 0/0