Molecular Definition

Canonical SMILES CCCOCCN1C(=O)C(=Nc2ncc(cc12)c3ccc(OC)nc3)NCC(=O)N4CCOCC4
Formula C24H30N6O5
Molecular Weight 482.53 da
Stereocenters 0/0