Molecular Definition

Canonical SMILES CN1CCN(CC1)c2cc(C3=C(C(=O)NC3=O)c4c[nH]c5ccccc45)c6ccccc6c2
Formula C27H24N4O2
Molecular Weight 436.51 da
Stereocenters 0/0