Molecular Definition

Canonical SMILES CCCOCCN1C(=O)C(=Nc2cnc(cc12)c3ccc(OC)nc3)NCC(=O)N4CCN(CC)CC4
Formula C26H35N7O4
Molecular Weight 509.60 da
Stereocenters 0/0