Molecular Definition

Canonical SMILES CCCOCCN1C(=O)C(=Nc2cnc(cc12)c3ccc(OC)nc3)NCCN(C)C
Formula C22H30N6O3
Molecular Weight 426.51 da
Stereocenters 0/0