Molecular Definition

Canonical SMILES CCNc1nc(nc2c1ncn2c3cc(F)cc(F)c3)C#N
Formula C14H10F2N6
Molecular Weight 300.27 da
Stereocenters 0/0