Molecular Definition

Canonical SMILES CCCOCCN1C(=O)C(=Nc2ncc(cc12)c3ccc(OC)nc3)NCC(=O)N
Formula C20H24N6O4
Molecular Weight 412.44 da
Stereocenters 0/0