Molecular Definition

Canonical SMILES OS(=O)(=O)CCN1C(=S)S\C(=C/c2cn(nc2c3ccc(OCc4ccccc4)cc3)c5ccccc5)\C1=O
Formula C28H23N3O5S3
Molecular Weight 577.69 da
Stereocenters 0/0