Molecular Definition

Canonical SMILES OS(=O)(=O)CCN1C(=S)S\C(=C/c2cn(nc2c3ccc(cc3)S(=O)(=O)N4CCCCC4)c5ccccc5)\C1=O
Formula C26H26N4O6S4
Molecular Weight 618.77 da
Stereocenters 0/0