Target Relevance

Molecular Definition

Canonical SMILES Cc1ncccc1Oc2ccc(NC(=O)N3CCc4ccccc34)cn2
Formula C20H18N4O2
Molecular Weight 346.38 da
Stereocenters 0/0