Molecular Definition

Canonical SMILES Clc1cc(OC(=O)N2CCN3CCC2CC3)ccc1Br
Formula C14H16BrClN2O2
Molecular Weight 359.65 da
Stereocenters 0/0