Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)N1CCN(CC1)C(=O)[C@H](CCC(=O)O)NC(=O)c2cc(OC)cc(n2)c3ccccc3
Formula C25H30N4O7
Molecular Weight 498.53 da
Stereocenters 1/1