Molecular Definition

Canonical SMILES C[C@@H]1CNc2c(sc3ccc4nc(Cl)ccc4c23)C(=O)N1
Formula C15H12ClN3OS
Molecular Weight 317.79 da
Stereocenters 1/1