Molecular Definition

Canonical SMILES CC1(C)SCC(CCC(=O)Nc2ccc3CO[C@@H](Cc3c2)C(=O)O)S1
Formula C18H23NO4S2
Molecular Weight 381.51 da
Stereocenters 1/2