Molecular Definition

Canonical SMILES Fc1cc(OC(=O)N2CCN3CCC2CC3)ccc1Cl
Formula C14H16ClFN2O2
Molecular Weight 298.74 da
Stereocenters 0/0