Target Relevance

Molecular Definition

Canonical SMILES Cl.NC(CC(=O)c1ccc(Cl)c(Cl)c1)C(=O)O
Formula C10H10Cl3NO3
Molecular Weight 298.55 da
Stereocenters 0/1