Molecular Definition

Canonical SMILES COc1ccc2sc3C(=O)N[C@H](CO)CNc3c2c1
Formula C13H14N2O3S
Molecular Weight 278.33 da
Stereocenters 1/1