Molecular Definition

Canonical SMILES Clc1ccc(OC(=O)N2CCN3CCC2CC3)cc1Cl
Formula C14H16Cl2N2O2
Molecular Weight 315.20 da
Stereocenters 0/0