Target Relevance

Molecular Definition

Canonical SMILES CCOC(=O)N1CCN(CC1)C(=O)[C@H](CCC(=O)O)NC(=O)c2cc(NCCOC)cc(n2)c3ccccc3
Formula C27H35N5O7
Molecular Weight 541.60 da
Stereocenters 1/1