Molecular Definition

Canonical SMILES CCCOCCN1C(=O)C(=Nc2ncc(cc12)c3ccc(OC)nc3)NCCN4CCOCC4
Formula C24H32N6O4
Molecular Weight 468.55 da
Stereocenters 0/0