Molecular Definition

Canonical SMILES CNC(=O)c1ccc(cc1)c2ccc(cc2)C(=O)NCCCCN3CCc4ccc(OS(=O)(=O)C(F)(F)F)cc4C3
Formula C29H30F3N3O5S
Molecular Weight 589.63 da
Stereocenters 0/0