Molecular Definition

Canonical SMILES Cl.Cl.CNc1cncc(N(C)C)c1CN
Formula C9H18Cl2N4
Molecular Weight 253.17 da
Stereocenters 0/0