Target Relevance

Molecular Definition

Canonical SMILES CN1[C@@H](Cc2ccc(Oc3cc4cc(c3O)c5cccc6c(C[C@@H](NC(=O)C(=O)c7cc(Cl)c(O)c(Cl)c7)C(=O)N[C@@H](C(=O)N[C@H]4C(=O)N[C@@H](C1=O)c8cc(Cl)c(O)c(Cl)c8)c9cc(Cl)c(O)c(Cl)c9)c[nH]c56)cc2)C(=O)N[C@@H](C(=O)O)c%10ccc(O)cc%10
Formula C61H45Cl6N7O15
Molecular Weight 1328.77 da
Stereocenters 6/6