Molecular Definition

Canonical SMILES COc1ccc2c(c1)c(CC(NS(=O)(=O)c3ccc(OCC#CC)cc3)C(=O)O)c(C)n2C
Formula C24H26N2O6S
Molecular Weight 470.54 da
Stereocenters 0/1