Target Relevance

Molecular Definition

Canonical SMILES C\C(=C/CC1OC(=O)C=C1C)\CC[C@H]2[C@](C)(O)C[C@H](O)[C@@H]3[C@]2(C)CCC[C@@]3(C)C(=O)O
Formula C25H38O6
Molecular Weight 434.57 da
Stereocenters 6/7