Target Relevance

Molecular Definition

Canonical SMILES CCCCCCCCc1onc(n1)N2CCc3cc(ccc23)S(=O)(=O)Nc4ccccc4
Formula C24H30N4O3S
Molecular Weight 454.59 da
Stereocenters 0/0