Target Relevance

Molecular Definition

Canonical SMILES CCO[C@H]1O[C@H]2C[C@@](C)(O)[C@H](CC\C(=C\[C@H](O)[C@H]3OC(=O)C=C3C)\C)[C@@]4(C)CCC[C@]1(C)[C@H]24
Formula C27H42O6
Molecular Weight 462.62 da
Stereocenters 9/9