Target Relevance

Molecular Definition

Canonical SMILES O=C1N(Cc2ccccc2)c3ccc(cc3C1=C(C#N)C#N)S(=O)(=O)N4CCCCC4
Formula C23H20N4O3S
Molecular Weight 432.50 da
Stereocenters 0/0